C11H18N2O3S2 — CID 82901625
4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N-methylbenzenesulfonamide (PubChem CID 82901625) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 82901625 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-amino-3-(4-hydroxybutan-2-ylsulfanyl)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N)c(SC(C)CCO)c1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-8(5-6-14)17-11-7-9(3-4-10(11)12)18(15,16)13-2/h3-4,7-8,13-14H,5-6,12H2,1-2H3 |
| InChIKey | JFSZNIBLSVOOOG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|