C13H20N2O2S — CID 82989699
3-amino-4-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzamide (PubChem CID 82989699) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 3-amino-4-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82989699 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-amino-4-(4-hydroxybutan-2-ylsulfanyl)-N,N-dimethylbenzamide |
| SMILES | CC(CCO)Sc1ccc(C(=O)N(C)C)cc1N |
| InChI | InChI=1S/C13H20N2O2S/c1-9(6-7-16)18-12-5-4-10(8-11(12)14)13(17)15(2)3/h4-5,8-9,16H,6-7,14H2,1-3H3 |
| InChIKey | YJUATILFLSRNTQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|