C12H18N2O3S — CID 82990247
3-amino-4-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylbenzamide (PubChem CID 82990247) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-amino-4-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82990247 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-amino-4-(2,3-dihydroxypropylsulfanyl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(SCC(O)CO)c(N)c1 |
| InChI | InChI=1S/C12H18N2O3S/c1-14(2)12(17)8-3-4-11(10(13)5-8)18-7-9(16)6-15/h3-5,9,15-16H,6-7,13H2,1-2H3 |
| InChIKey | SROMVKBLRSXKEW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|