C16H27N3O2 — CID 107151012
3-amino-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-N,N-dimethylbenzamide (PubChem CID 107151012) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-amino-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 107151012 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-amino-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NCC(O)CC(C)(C)C)c(N)c1 |
| InChI | InChI=1S/C16H27N3O2/c1-16(2,3)9-12(20)10-18-14-7-6-11(8-13(14)17)15(21)19(4)5/h6-8,12,18,20H,9-10,17H2,1-5H3 |
| InChIKey | OWHURFPAQRNAEC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|