C15H25N3O2 — CID 107150888
4-amino-3-[(2-hydroxy-4,4-dimethylpentyl)amino]-N-methylbenzamide (PubChem CID 107150888) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 4-amino-3-[(2-hydroxy-4,4-dimethylpentyl)amino]-N-methylbenzamide.
| Compound Name | 4-amino-3-[(2-hydroxy-4,4-dimethylpentyl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 107150888 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 4-amino-3-[(2-hydroxy-4,4-dimethylpentyl)amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N)c(NCC(O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C15H25N3O2/c1-15(2,3)8-11(19)9-18-13-7-10(14(20)17-4)5-6-12(13)16/h5-7,11,18-19H,8-9,16H2,1-4H3,(H,17,20) |
| InChIKey | BAYJBIKOXLLJLT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|