2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid

C15H13N3O6S — CID 10832529

IUPAC2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid
SMILESO=C(O)CN(Cc1ccccc1)Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C15H13N3O6S/c19-15(20)10-16(9-11-4-2-1-3-5-11)25-14-7-6-12(17(21)22)8-13(14)18(23)24/h1-8H,9-10H2,(H,19,20)
InChIKeyQTKIYASZMSKDMR-UHFFFAOYSA-N
MW363.35 g/mol
LogP3.10
Rot. Bonds8

About 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid

2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid (PubChem CID 10832529) has the molecular formula C15H13N3O6S and a molecular weight of 363.35 g/mol. Its IUPAC name is 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid.

Molecular Properties

Compound Name2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid
PubChem CID10832529
Molecular FormulaC15H13N3O6S
Molecular Weight363.35 g/mol
Exact Mass363.05
IUPAC Name2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid
SMILESO=C(O)CN(Cc1ccccc1)Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]
InChIInChI=1S/C15H13N3O6S/c19-15(20)10-16(9-11-4-2-1-3-5-11)25-14-7-6-12(17(21)22)8-13(14)18(23)24/h1-8H,9-10H2,(H,19,20)
InChIKeyQTKIYASZMSKDMR-UHFFFAOYSA-N
XLogP3.10
TPSA126.82 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.35
LogP ≤ 53.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid?
The IUPAC name of 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid (CID 10832529) is 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid.
What is the SMILES notation for 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid?
The canonical SMILES for 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid is O=C(O)CN(Cc1ccccc1)Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-].
What is the InChIKey of 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid?
The InChIKey is QTKIYASZMSKDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O6S/c19-15(20)10-16(9-11-4-2-1-3-5-11)25-14-7-6-12(17(21)22)8-13(14)18(23)24/h1-8H,9-10H2,(H,19,20).
What are the key properties of 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid?
2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid has a molecular weight of 363.35 g/mol, XLogP of 3.10, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[benzyl-(2,4-dinitrophenyl)sulfanylamino]acetic acid is sourced from PubChem (CID 10832529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).