C28H26N4O7 — CID 44888021
N,N-dibenzyl-2-phenylethanamine;2,4,6-trinitrophenol (PubChem CID 44888021) has the molecular formula C28H26N4O7 and a molecular weight of 530.54 g/mol. Its IUPAC name is N,N-dibenzyl-2-phenylethanamine;2,4,6-trinitrophenol.
| Compound Name | N,N-dibenzyl-2-phenylethanamine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 44888021 |
| Molecular Formula | C28H26N4O7 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | N,N-dibenzyl-2-phenylethanamine;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc(CCN(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N.C6H3N3O7/c1-4-10-20(11-5-1)16-17-23(18-21-12-6-2-7-13-21)19-22-14-8-3-9-15-22;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-15H,16-19H2;1-2,10H |
| InChIKey | AKBAKVJBURBLAJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|