C17H20N3O7S+ — CID 154879280
benzyl(diethyl)sulfanium;2,4,6-trinitrophenol (PubChem CID 154879280) has the molecular formula C17H20N3O7S+ and a molecular weight of 410.43 g/mol. Its IUPAC name is benzyl(diethyl)sulfanium;2,4,6-trinitrophenol.
| Compound Name | benzyl(diethyl)sulfanium;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 154879280 |
| Molecular Formula | C17H20N3O7S+ |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | benzyl(diethyl)sulfanium;2,4,6-trinitrophenol |
| SMILES | CC[S+](CC)Cc1ccccc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H17S.C6H3N3O7/c1-3-12(4-2)10-11-8-6-5-7-9-11;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h5-9H,3-4,10H2,1-2H3;1-2,10H/q+1; |
| InChIKey | UMHOTWJBUWPRIB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|