C12H13ClN2O4S — CID 6956233
1-[(1S,2R)-2-chlorocyclohexyl]sulfanyl-2,4-dinitrobenzene (PubChem CID 6956233) has the molecular formula C12H13ClN2O4S and a molecular weight of 316.77 g/mol. Its IUPAC name is 1-[(1S,2R)-2-chlorocyclohexyl]sulfanyl-2,4-dinitrobenzene.
| Compound Name | 1-[(1S,2R)-2-chlorocyclohexyl]sulfanyl-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 6956233 |
| Molecular Formula | C12H13ClN2O4S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-[(1S,2R)-2-chlorocyclohexyl]sulfanyl-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(S[C@H]2CCCC[C@H]2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13ClN2O4S/c13-9-3-1-2-4-11(9)20-12-6-5-8(14(16)17)7-10(12)15(18)19/h5-7,9,11H,1-4H2/t9-,11+/m1/s1 |
| InChIKey | LTAJOOMBQCYMBL-KOLCDFICSA-N |
| XLogP | 4.15 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|