C18H16N2O4S — CID 23246455
2,4-dinitro-1-(2-phenylcyclohex-2-en-1-yl)sulfanylbenzene (PubChem CID 23246455) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is 2,4-dinitro-1-(2-phenylcyclohex-2-en-1-yl)sulfanylbenzene.
| Compound Name | 2,4-dinitro-1-(2-phenylcyclohex-2-en-1-yl)sulfanylbenzene |
|---|---|
| PubChem CID | 23246455 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2,4-dinitro-1-(2-phenylcyclohex-2-en-1-yl)sulfanylbenzene |
| SMILES | O=[N+]([O-])c1ccc(SC2CCCC=C2c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N2O4S/c21-19(22)14-10-11-18(16(12-14)20(23)24)25-17-9-5-4-8-15(17)13-6-2-1-3-7-13/h1-3,6-8,10-12,17H,4-5,9H2 |
| InChIKey | KUAUFFRQLJNVJP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|