C21H20N4O4S — CID 54763233
4-cyclohexylsulfanyl-1-(2,4-dinitrophenyl)-3-phenylpyrazole (PubChem CID 54763233) has the molecular formula C21H20N4O4S and a molecular weight of 424.48 g/mol. Its IUPAC name is 4-cyclohexylsulfanyl-1-(2,4-dinitrophenyl)-3-phenylpyrazole.
| Compound Name | 4-cyclohexylsulfanyl-1-(2,4-dinitrophenyl)-3-phenylpyrazole |
|---|---|
| PubChem CID | 54763233 |
| Molecular Formula | C21H20N4O4S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-cyclohexylsulfanyl-1-(2,4-dinitrophenyl)-3-phenylpyrazole |
| SMILES | O=[N+]([O-])c1ccc(-n2cc(SC3CCCCC3)c(-c3ccccc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H20N4O4S/c26-24(27)16-11-12-18(19(13-16)25(28)29)23-14-20(30-17-9-5-2-6-10-17)21(22-23)15-7-3-1-4-8-15/h1,3-4,7-8,11-14,17H,2,5-6,9-10H2 |
| InChIKey | KDIHZUSVGQBUAQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|