About 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine
1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine (PubChem CID 134868283) has the molecular formula C15H20N4O4
and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine |
| PubChem CID | 134868283 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine |
| SMILES | CC1(C)N(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])N1C1CCCCC1 |
| InChI | InChI=1S/C15H20N4O4/c1-15(2)16(11-6-4-3-5-7-11)17(15)13-9-8-12(18(20)21)10-14(13)19(22)23/h8-11H,3-7H2,1-2H3 |
| InChIKey | YLMJTKKWJPGPAQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine?
The IUPAC name of 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine (CID 134868283) is 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine.
What is the SMILES notation for 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine?
The canonical SMILES for 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine is CC1(C)N(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])N1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine?
The InChIKey is YLMJTKKWJPGPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O4/c1-15(2)16(11-6-4-3-5-7-11)17(15)13-9-8-12(18(20)21)10-14(13)19(22)23/h8-11H,3-7H2,1-2H3.
What are the key properties of 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine?
1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine has a molecular weight of 320.35 g/mol, XLogP of 3.61, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-(2,4-dinitrophenyl)-3,3-dimethyldiaziridine is sourced from PubChem (CID 134868283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).