C19H14N6O4 — CID 88842181
2-(2,4-dinitrophenyl)-3,5-diphenyl-1H-tetrazole (PubChem CID 88842181) has the molecular formula C19H14N6O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-3,5-diphenyl-1H-tetrazole.
| Compound Name | 2-(2,4-dinitrophenyl)-3,5-diphenyl-1H-tetrazole |
|---|---|
| PubChem CID | 88842181 |
| Molecular Formula | C19H14N6O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-3,5-diphenyl-1H-tetrazole |
| SMILES | O=[N+]([O-])c1ccc(N2NC(c3ccccc3)=NN2c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N6O4/c26-24(27)16-11-12-17(18(13-16)25(28)29)23-21-19(14-7-3-1-4-8-14)20-22(23)15-9-5-2-6-10-15/h1-13H,(H,20,21) |
| InChIKey | XLXSHDOFQARJDL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|