C19H16ClN5O2 — CID 171375760
2-(4-nitrophenyl)-3,5-diphenyl-1H-tetrazole;hydrochloride (PubChem CID 171375760) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-3,5-diphenyl-1H-tetrazole;hydrochloride.
| Compound Name | 2-(4-nitrophenyl)-3,5-diphenyl-1H-tetrazole;hydrochloride |
|---|---|
| PubChem CID | 171375760 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-(4-nitrophenyl)-3,5-diphenyl-1H-tetrazole;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(N2NC(c3ccccc3)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15N5O2.ClH/c25-24(26)18-13-11-17(12-14-18)23-21-19(15-7-3-1-4-8-15)20-22(23)16-9-5-2-6-10-16;/h1-14H,(H,20,21);1H |
| InChIKey | ITGQYGGUISQXHU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|