C25H19N7O8S2 — CID 87582799
2-[3-(4-nitrophenyl)-5-phenyl-1H-tetrazol-2-yl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 87582799) has the molecular formula C25H19N7O8S2 and a molecular weight of 609.60 g/mol. Its IUPAC name is 2-[3-(4-nitrophenyl)-5-phenyl-1H-tetrazol-2-yl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[3-(4-nitrophenyl)-5-phenyl-1H-tetrazol-2-yl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87582799 |
| Molecular Formula | C25H19N7O8S2 |
| Molecular Weight | 609.60 g/mol |
| Exact Mass | 609.07 |
| IUPAC Name | 2-[3-(4-nitrophenyl)-5-phenyl-1H-tetrazol-2-yl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)NN2c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C25H19N7O8S2/c33-32(34)21-11-9-20(10-12-21)30-28-25(17-4-2-1-3-5-17)29-31(30)23-15-8-19(16-24(23)42(38,39)40)27-26-18-6-13-22(14-7-18)41(35,36)37/h1-16H,(H,28,29)(H,35,36,37)(H,38,39,40)/b27-26+ |
| InChIKey | HRCWHPJWGDXLHA-CYYJNZCTSA-N |
| XLogP | 4.61 |
| TPSA | 207.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|