C21H19N6O3S+ — CID 160787115
5-[(4-methylphenyl)diazenyl]-2-(3-methyl-5-phenyltetrazol-3-ium-2-yl)benzenesulfonic acid (PubChem CID 160787115) has the molecular formula C21H19N6O3S+ and a molecular weight of 435.49 g/mol. Its IUPAC name is 5-[(4-methylphenyl)diazenyl]-2-(3-methyl-5-phenyltetrazol-3-ium-2-yl)benzenesulfonic acid.
| Compound Name | 5-[(4-methylphenyl)diazenyl]-2-(3-methyl-5-phenyltetrazol-3-ium-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 160787115 |
| Molecular Formula | C21H19N6O3S+ |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 5-[(4-methylphenyl)diazenyl]-2-(3-methyl-5-phenyltetrazol-3-ium-2-yl)benzenesulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(-n3nc(-c4ccccc4)n[n+]3C)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C21H18N6O3S/c1-15-8-10-17(11-9-15)22-23-18-12-13-19(20(14-18)31(28,29)30)27-25-21(24-26(27)2)16-6-4-3-5-7-16/h3-14H,1-2H3/p+1/b23-22+ |
| InChIKey | BGPJVUZIQIXPHG-GHVJWSGMSA-O |
| XLogP | 3.73 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|