C26H19N7O5S — CID 134164447
5-[(4-methylphenyl)diazenyl]-2-[3-(4-nitrophenyl)-5-phenyltetrazol-2-ium-2-yl]benzenesulfonate (PubChem CID 134164447) has the molecular formula C26H19N7O5S and a molecular weight of 541.55 g/mol. Its IUPAC name is 5-[(4-methylphenyl)diazenyl]-2-[3-(4-nitrophenyl)-5-phenyltetrazol-2-ium-2-yl]benzenesulfonate.
| Compound Name | 5-[(4-methylphenyl)diazenyl]-2-[3-(4-nitrophenyl)-5-phenyltetrazol-2-ium-2-yl]benzenesulfonate |
|---|---|
| PubChem CID | 134164447 |
| Molecular Formula | C26H19N7O5S |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 5-[(4-methylphenyl)diazenyl]-2-[3-(4-nitrophenyl)-5-phenyltetrazol-2-ium-2-yl]benzenesulfonate |
| SMILES | Cc1ccc(/N=N/c2ccc(-[n+]3nc(-c4ccccc4)nn3-c3ccc([N+](=O)[O-])cc3)c(S(=O)(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H19N7O5S/c1-18-7-9-20(10-8-18)27-28-21-11-16-24(25(17-21)39(36,37)38)32-30-26(19-5-3-2-4-6-19)29-31(32)22-12-14-23(15-13-22)33(34)35/h2-17H,1H3/b28-27+ |
| InChIKey | HHNBNPVHHIGVKE-BYYHNAKLSA-N |
| XLogP | 4.75 |
| TPSA | 159.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|