C19H12N7O9S+ — CID 140902186
2-[2-(2,4-dinitrophenyl)-3-(4-nitrophenyl)tetrazol-2-ium-5-yl]benzenesulfonic acid (PubChem CID 140902186) has the molecular formula C19H12N7O9S+ and a molecular weight of 514.41 g/mol. Its IUPAC name is 2-[2-(2,4-dinitrophenyl)-3-(4-nitrophenyl)tetrazol-2-ium-5-yl]benzenesulfonic acid.
| Compound Name | 2-[2-(2,4-dinitrophenyl)-3-(4-nitrophenyl)tetrazol-2-ium-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 140902186 |
| Molecular Formula | C19H12N7O9S+ |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 2-[2-(2,4-dinitrophenyl)-3-(4-nitrophenyl)tetrazol-2-ium-5-yl]benzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(-c3ccccc3S(=O)(=O)O)n[n+]2-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H11N7O9S/c27-24(28)13-7-5-12(6-8-13)22-20-19(15-3-1-2-4-18(15)36(33,34)35)21-23(22)16-10-9-14(25(29)30)11-17(16)26(31)32/h1-11H/p+1 |
| InChIKey | YWMUNKRBCVTDNY-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 218.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|