C17H13N6O7S+ — CID 129143534
2-[2-(2-methoxy-4-nitrophenyl)-3-(1,3-oxazol-4-yl)tetrazol-3-ium-5-yl]benzenesulfonic acid (PubChem CID 129143534) has the molecular formula C17H13N6O7S+ and a molecular weight of 445.39 g/mol. Its IUPAC name is 2-[2-(2-methoxy-4-nitrophenyl)-3-(1,3-oxazol-4-yl)tetrazol-3-ium-5-yl]benzenesulfonic acid.
| Compound Name | 2-[2-(2-methoxy-4-nitrophenyl)-3-(1,3-oxazol-4-yl)tetrazol-3-ium-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 129143534 |
| Molecular Formula | C17H13N6O7S+ |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 2-[2-(2-methoxy-4-nitrophenyl)-3-(1,3-oxazol-4-yl)tetrazol-3-ium-5-yl]benzenesulfonic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1-n1nc(-c2ccccc2S(=O)(=O)O)n[n+]1-c1cocn1 |
| InChI | InChI=1S/C17H12N6O7S/c1-29-14-8-11(23(24)25)6-7-13(14)21-19-17(20-22(21)16-9-30-10-18-16)12-4-2-3-5-15(12)31(26,27)28/h2-10H,1H3/p+1 |
| InChIKey | GBCDCYFOKQFRKC-UHFFFAOYSA-O |
| XLogP | 1.36 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|