C18H15N7O6S — CID 129143555
2-[2-(2-methoxy-4-nitrophenyl)-3-pyridazin-4-yl-1H-tetrazol-5-yl]benzenesulfonic acid (PubChem CID 129143555) has the molecular formula C18H15N7O6S and a molecular weight of 457.43 g/mol. Its IUPAC name is 2-[2-(2-methoxy-4-nitrophenyl)-3-pyridazin-4-yl-1H-tetrazol-5-yl]benzenesulfonic acid.
| Compound Name | 2-[2-(2-methoxy-4-nitrophenyl)-3-pyridazin-4-yl-1H-tetrazol-5-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 129143555 |
| Molecular Formula | C18H15N7O6S |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 2-[2-(2-methoxy-4-nitrophenyl)-3-pyridazin-4-yl-1H-tetrazol-5-yl]benzenesulfonic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1NC(c2ccccc2S(=O)(=O)O)=NN1c1ccnnc1 |
| InChI | InChI=1S/C18H15N7O6S/c1-31-16-10-12(25(26)27)6-7-15(16)24-22-18(21-23(24)13-8-9-19-20-11-13)14-4-2-3-5-17(14)32(28,29)30/h2-11H,1H3,(H,21,22)(H,28,29,30) |
| InChIKey | OVMCXVXRXLTBIT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 163.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|