C10H9N3O5 — CID 107842288
3-(2-methoxy-4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 107842288) has the molecular formula C10H9N3O5 and a molecular weight of 251.20 g/mol. Its IUPAC name is 3-(2-methoxy-4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | 3-(2-methoxy-4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 107842288 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-(2-methoxy-4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1C(=O)CNC1=O |
| InChI | InChI=1S/C10H9N3O5/c1-18-8-4-6(13(16)17)2-3-7(8)12-9(14)5-11-10(12)15/h2-4H,5H2,1H3,(H,11,15) |
| InChIKey | UQBUNFRFIACIEV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|