About 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide
2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide (PubChem CID 173024149) has the molecular formula C21H16BrN5O2S
and a molecular weight of 482.36 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide.
Molecular Properties
| Compound Name | 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide |
| PubChem CID | 173024149 |
| Molecular Formula | C21H16BrN5O2S |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide |
| SMILES | Br.O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)NN2c2cc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H15N5O2S.BrH/c27-26(28)18-12-10-17(11-13-18)24-22-21(15-6-2-1-3-7-15)23-25(24)20-14-16-8-4-5-9-19(16)29-20;/h1-14H,(H,22,23);1H |
| InChIKey | ZMJJKYRUNTYVOR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide?
The IUPAC name of 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide (CID 173024149) is 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide.
What is the SMILES notation for 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide?
The canonical SMILES for 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide is Br.O=[N+]([O-])c1ccc(N2N=C(c3ccccc3)NN2c2cc3ccccc3s2)cc1.
What is the InChIKey of 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide?
The InChIKey is ZMJJKYRUNTYVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N5O2S.BrH/c27-26(28)18-12-10-17(11-13-18)24-22-21(15-6-2-1-3-7-15)23-25(24)20-14-16-8-4-5-9-19(16)29-20;/h1-14H,(H,22,23);1H.
What are the key properties of 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide?
2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide has a molecular weight of 482.36 g/mol, XLogP of 5.50, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzothiophen-2-yl)-3-(4-nitrophenyl)-5-phenyl-1H-tetrazole;hydrobromide is sourced from PubChem (CID 173024149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).