C20H13ClN6O2S — CID 19784976
2-[5-(4-chlorophenyl)-3-(4-nitrophenyl)-1H-tetrazol-2-yl]-1,3-benzothiazole (PubChem CID 19784976) has the molecular formula C20H13ClN6O2S and a molecular weight of 436.88 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-3-(4-nitrophenyl)-1H-tetrazol-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[5-(4-chlorophenyl)-3-(4-nitrophenyl)-1H-tetrazol-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 19784976 |
| Molecular Formula | C20H13ClN6O2S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-3-(4-nitrophenyl)-1H-tetrazol-2-yl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccc(Cl)cc3)NN2c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H13ClN6O2S/c21-14-7-5-13(6-8-14)19-23-25(15-9-11-16(12-10-15)27(28)29)26(24-19)20-22-17-3-1-2-4-18(17)30-20/h1-12H,(H,23,24) |
| InChIKey | FQYLAHZWZVBJMI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|