C23H12ClN3O4S — CID 2036503
3-(4-chlorophenyl)-2-(4-nitrophenyl)thiochromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 2036503) has the molecular formula C23H12ClN3O4S and a molecular weight of 461.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(4-nitrophenyl)thiochromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 3-(4-chlorophenyl)-2-(4-nitrophenyl)thiochromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 2036503 |
| Molecular Formula | C23H12ClN3O4S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(4-nitrophenyl)thiochromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | O=c1c2ccccc2sc2nc(-c3ccc([N+](=O)[O-])cc3)n(-c3ccc(Cl)cc3)c(=O)c12 |
| InChI | InChI=1S/C23H12ClN3O4S/c24-14-7-11-15(12-8-14)26-21(13-5-9-16(10-6-13)27(30)31)25-22-19(23(26)29)20(28)17-3-1-2-4-18(17)32-22/h1-12H |
| InChIKey | ZHNILQGIVBOGNG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|