C16H9N3O3S — CID 4667584
3-(4-nitrophenyl)-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4667584) has the molecular formula C16H9N3O3S and a molecular weight of 323.33 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(4-nitrophenyl)-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4667584 |
| Molecular Formula | C16H9N3O3S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-(4-nitrophenyl)-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2c(ncn1-c1ccc([N+](=O)[O-])cc1)sc1ccccc12 |
| InChI | InChI=1S/C16H9N3O3S/c20-16-14-12-3-1-2-4-13(12)23-15(14)17-9-18(16)10-5-7-11(8-6-10)19(21)22/h1-9H |
| InChIKey | ZBQZJLJJWBCITR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|