C19H11N5O3S — CID 6285852
2-[(Z)-C-ethynyl-N-(4-nitroanilino)carbonimidoyl]-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 6285852) has the molecular formula C19H11N5O3S and a molecular weight of 389.40 g/mol. Its IUPAC name is 2-[(Z)-C-ethynyl-N-(4-nitroanilino)carbonimidoyl]-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[(Z)-C-ethynyl-N-(4-nitroanilino)carbonimidoyl]-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 6285852 |
| Molecular Formula | C19H11N5O3S |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-[(Z)-C-ethynyl-N-(4-nitroanilino)carbonimidoyl]-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C#C/C(=N/Nc1ccc([N+](=O)[O-])cc1)c1nc2sc3ccccc3c2c(=O)[nH]1 |
| InChI | InChI=1S/C19H11N5O3S/c1-2-14(23-22-11-7-9-12(10-8-11)24(26)27)17-20-18(25)16-13-5-3-4-6-15(13)28-19(16)21-17/h1,3-10,22H,(H,20,21,25)/b23-14- |
| InChIKey | BXFNEDHPAAVTNC-UCQKPKSFSA-N |
| XLogP | 3.50 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|