C23H20N2O2S — CID 2034964
2-cyclohexyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 2034964) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-cyclohexyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 2-cyclohexyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 2034964 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-cyclohexyl-3-phenylthiochromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | O=c1c2ccccc2sc2nc(C3CCCCC3)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C23H20N2O2S/c26-20-17-13-7-8-14-18(17)28-22-19(20)23(27)25(16-11-5-2-6-12-16)21(24-22)15-9-3-1-4-10-15/h2,5-8,11-15H,1,3-4,9-10H2 |
| InChIKey | OYIAMYGTDDFOLN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|