C20H20IrN3- — CID 58240240
3-cyclohexyl-4-phenyl-5-phenyl-1,2,4-triazole;iridium (PubChem CID 58240240) has the molecular formula C20H20IrN3- and a molecular weight of 494.62 g/mol. Its IUPAC name is 3-cyclohexyl-4-phenyl-5-phenyl-1,2,4-triazole;iridium.
| Compound Name | 3-cyclohexyl-4-phenyl-5-phenyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 58240240 |
| Molecular Formula | C20H20IrN3- |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 3-cyclohexyl-4-phenyl-5-phenyl-1,2,4-triazole;iridium |
| SMILES | [Ir].[c-]1ccccc1-c1nnc(C2CCCCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H20N3.Ir/c1-4-10-16(11-5-1)19-21-22-20(17-12-6-2-7-13-17)23(19)18-14-8-3-9-15-18;/h1,3-5,8-10,14-15,17H,2,6-7,12-13H2;/q-1; |
| InChIKey | BZNFVBAAVUIEEB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|