C28H27IrN2- — CID 140756461
7-(2,6-dimethylphenyl)-6-phenyl-5,7-diazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;iridium (PubChem CID 140756461) has the molecular formula C28H27IrN2- and a molecular weight of 583.76 g/mol. Its IUPAC name is 7-(2,6-dimethylphenyl)-6-phenyl-5,7-diazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;iridium.
| Compound Name | 7-(2,6-dimethylphenyl)-6-phenyl-5,7-diazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;iridium |
|---|---|
| PubChem CID | 140756461 |
| Molecular Formula | C28H27IrN2- |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 7-(2,6-dimethylphenyl)-6-phenyl-5,7-diazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;iridium |
| SMILES | Cc1cccc(C)c1-n1c(-c2[c-]cccc2)nc2cc3c(cc21)C1CCCC3CC1.[Ir] |
| InChI | InChI=1S/C28H27N2.Ir/c1-18-8-6-9-19(2)27(18)30-26-17-24-21-13-7-12-20(14-15-21)23(24)16-25(26)29-28(30)22-10-4-3-5-11-22;/h3-6,8-10,16-17,20-21H,7,12-15H2,1-2H3;/q-1; |
| InChIKey | CPRSXADGPXYWIS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|