C22H19IrN2- — CID 59546951
1-(2,6-dimethylphenyl)-2-phenyl-5-(trideuteriomethyl)benzimidazole;iridium (PubChem CID 59546951) has the molecular formula C22H19IrN2- and a molecular weight of 506.64 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-2-phenyl-5-(trideuteriomethyl)benzimidazole;iridium.
| Compound Name | 1-(2,6-dimethylphenyl)-2-phenyl-5-(trideuteriomethyl)benzimidazole;iridium |
|---|---|
| PubChem CID | 59546951 |
| Molecular Formula | C22H19IrN2- |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-2-phenyl-5-(trideuteriomethyl)benzimidazole;iridium |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)nc(-c1[c-]cccc1)n2-c1c(C)cccc1C.[Ir] |
| InChI | InChI=1S/C22H19N2.Ir/c1-15-12-13-20-19(14-15)23-22(18-10-5-4-6-11-18)24(20)21-16(2)8-7-9-17(21)3;/h4-10,12-14H,1-3H3;/q-1;/i1D3; |
| InChIKey | UACGNDCEMOQGEE-NIIDSAIPSA-N |
| XLogP | 5.42 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|