C17H15ClIrN3- — CID 155646291
3-chloro-5-phenyl-1-(2,4,6-trimethylphenyl)-1,2,4-triazole;iridium (PubChem CID 155646291) has the molecular formula C17H15ClIrN3- and a molecular weight of 489.00 g/mol. Its IUPAC name is 3-chloro-5-phenyl-1-(2,4,6-trimethylphenyl)-1,2,4-triazole;iridium.
| Compound Name | 3-chloro-5-phenyl-1-(2,4,6-trimethylphenyl)-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 155646291 |
| Molecular Formula | C17H15ClIrN3- |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 3-chloro-5-phenyl-1-(2,4,6-trimethylphenyl)-1,2,4-triazole;iridium |
| SMILES | Cc1cc(C)c(-n2nc(Cl)nc2-c2[c-]cccc2)c(C)c1.[Ir] |
| InChI | InChI=1S/C17H15ClN3.Ir/c1-11-9-12(2)15(13(3)10-11)21-16(19-17(18)20-21)14-7-5-4-6-8-14;/h4-7,9-10H,1-3H3;/q-1; |
| InChIKey | STUVKAVCMJKTIZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|