C15H12IrN3- — CID 140582460
iridium;1-(2-methylphenyl)-5-phenyl-1,2,4-triazole (PubChem CID 140582460) has the molecular formula C15H12IrN3- and a molecular weight of 426.50 g/mol. Its IUPAC name is iridium;1-(2-methylphenyl)-5-phenyl-1,2,4-triazole.
| Compound Name | iridium;1-(2-methylphenyl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 140582460 |
| Molecular Formula | C15H12IrN3- |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | iridium;1-(2-methylphenyl)-5-phenyl-1,2,4-triazole |
| SMILES | Cc1ccccc1-n1ncnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C15H12N3.Ir/c1-12-7-5-6-10-14(12)18-15(16-11-17-18)13-8-3-2-4-9-13;/h2-8,10-11H,1H3;/q-1; |
| InChIKey | DVCIVFSYXURFNG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|