C22H19IrN4- — CID 161210926
2,6-dimethyl-3-[3-(2-methylphenyl)-5-phenyl-1,2,4-triazol-4-yl]pyridine;iridium (PubChem CID 161210926) has the molecular formula C22H19IrN4- and a molecular weight of 531.64 g/mol. Its IUPAC name is 2,6-dimethyl-3-[3-(2-methylphenyl)-5-phenyl-1,2,4-triazol-4-yl]pyridine;iridium.
| Compound Name | 2,6-dimethyl-3-[3-(2-methylphenyl)-5-phenyl-1,2,4-triazol-4-yl]pyridine;iridium |
|---|---|
| PubChem CID | 161210926 |
| Molecular Formula | C22H19IrN4- |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2,6-dimethyl-3-[3-(2-methylphenyl)-5-phenyl-1,2,4-triazol-4-yl]pyridine;iridium |
| SMILES | Cc1ccc(-n2c(-c3[c-]cccc3)nnc2-c2ccccc2C)c(C)n1.[Ir] |
| InChI | InChI=1S/C22H19N4.Ir/c1-15-9-7-8-12-19(15)22-25-24-21(18-10-5-4-6-11-18)26(22)20-14-13-16(2)23-17(20)3;/h4-10,12-14H,1-3H3;/q-1; |
| InChIKey | NFCZMQROTBKCHZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|