C21H18N4 — CID 130422868
3-(3,5-diphenyl-1,2,4-triazol-4-yl)-2,6-dimethylpyridine (PubChem CID 130422868) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-(3,5-diphenyl-1,2,4-triazol-4-yl)-2,6-dimethylpyridine.
| Compound Name | 3-(3,5-diphenyl-1,2,4-triazol-4-yl)-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 130422868 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-(3,5-diphenyl-1,2,4-triazol-4-yl)-2,6-dimethylpyridine |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nnc2-c2ccccc2)c(C)n1 |
| InChI | InChI=1S/C21H18N4/c1-15-13-14-19(16(2)22-15)25-20(17-9-5-3-6-10-17)23-24-21(25)18-11-7-4-8-12-18/h3-14H,1-2H3 |
| InChIKey | ILRLUSIRAHWZRK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |