C14H11N3O — CID 14382453
4-hydroxy-3,5-diphenyl-1,2,4-triazole (PubChem CID 14382453) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-hydroxy-3,5-diphenyl-1,2,4-triazole.
| Compound Name | 4-hydroxy-3,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 14382453 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-hydroxy-3,5-diphenyl-1,2,4-triazole |
| SMILES | On1c(-c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C14H11N3O/c18-17-13(11-7-3-1-4-8-11)15-16-14(17)12-9-5-2-6-10-12/h1-10,18H |
| InChIKey | AQQPCYDGNCHNTC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|