C9H10N4S — CID 869419
3-methylsulfanyl-5-phenyl-1,2,4-triazol-4-amine (PubChem CID 869419) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-methylsulfanyl-5-phenyl-1,2,4-triazol-4-amine.
| Compound Name | 3-methylsulfanyl-5-phenyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 869419 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-methylsulfanyl-5-phenyl-1,2,4-triazol-4-amine |
| SMILES | CSc1nnc(-c2ccccc2)n1N |
| InChI | InChI=1S/C9H10N4S/c1-14-9-12-11-8(13(9)10)7-5-3-2-4-6-7/h2-6H,10H2,1H3 |
| InChIKey | ZAMJVZKIXCBPAH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |