C9H11N5S2 — CID 176894684
2-amino-4-(4-amino-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenethiol (PubChem CID 176894684) has the molecular formula C9H11N5S2 and a molecular weight of 253.36 g/mol. Its IUPAC name is 2-amino-4-(4-amino-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenethiol.
| Compound Name | 2-amino-4-(4-amino-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenethiol |
|---|---|
| PubChem CID | 176894684 |
| Molecular Formula | C9H11N5S2 |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-amino-4-(4-amino-5-methylsulfanyl-1,2,4-triazol-3-yl)benzenethiol |
| SMILES | CSc1nnc(-c2ccc(S)c(N)c2)n1N |
| InChI | InChI=1S/C9H11N5S2/c1-16-9-13-12-8(14(9)11)5-2-3-7(15)6(10)4-5/h2-4,15H,10-11H2,1H3 |
| InChIKey | ZKRKSDCWVUHGSO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|