C8H10N6O — CID 136872415
2-amino-4-(4,5-diamino-1,2,4-triazol-3-yl)phenol (PubChem CID 136872415) has the molecular formula C8H10N6O and a molecular weight of 206.21 g/mol. Its IUPAC name is 2-amino-4-(4,5-diamino-1,2,4-triazol-3-yl)phenol.
| Compound Name | 2-amino-4-(4,5-diamino-1,2,4-triazol-3-yl)phenol |
|---|---|
| PubChem CID | 136872415 |
| Molecular Formula | C8H10N6O |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-amino-4-(4,5-diamino-1,2,4-triazol-3-yl)phenol |
| SMILES | Nc1cc(-c2nnc(N)n2N)ccc1O |
| InChI | InChI=1S/C8H10N6O/c9-5-3-4(1-2-6(5)15)7-12-13-8(10)14(7)11/h1-3,15H,9,11H2,(H2,10,13) |
| InChIKey | VZUOWSVIVIBORD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|