About 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane
2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane (PubChem CID 134204994) has the molecular formula C13H14F2N2O2
and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane.
Molecular Properties
| Compound Name | 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane |
| PubChem CID | 134204994 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane |
| SMILES | FCF.Nc1cc(-c2ccc(N)c(O)c2)ccc1O |
| InChI | InChI=1S/C12H12N2O2.CH2F2/c13-9-3-1-8(6-12(9)16)7-2-4-11(15)10(14)5-7;2-1-3/h1-6,15-16H,13-14H2;1H2 |
| InChIKey | PRJLVNWQOFJBFR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane?
The IUPAC name of 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane (CID 134204994) is 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane.
What is the SMILES notation for 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane?
The canonical SMILES for 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane is FCF.Nc1cc(-c2ccc(N)c(O)c2)ccc1O.
What is the InChIKey of 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane?
The InChIKey is PRJLVNWQOFJBFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2.CH2F2/c13-9-3-1-8(6-12(9)16)7-2-4-11(15)10(14)5-7;2-1-3/h1-6,15-16H,13-14H2;1H2.
What are the key properties of 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane?
2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane has a molecular weight of 268.26 g/mol, XLogP of 2.81, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(3-amino-4-hydroxyphenyl)phenol;difluoromethane is sourced from PubChem (CID 134204994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).