C13H14N2O — CID 135755462
2-amino-4-(2,6-dimethyl-4-pyridinyl)phenol (PubChem CID 135755462) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-amino-4-(2,6-dimethyl-4-pyridinyl)phenol.
| Compound Name | 2-amino-4-(2,6-dimethyl-4-pyridinyl)phenol |
|---|---|
| PubChem CID | 135755462 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-amino-4-(2,6-dimethyl-4-pyridinyl)phenol |
| SMILES | Cc1cc(-c2ccc(O)c(N)c2)cc(C)n1 |
| InChI | InChI=1S/C13H14N2O/c1-8-5-11(6-9(2)15-8)10-3-4-13(16)12(14)7-10/h3-7,16H,14H2,1-2H3 |
| InChIKey | MZIRCUOERTUJKX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|