C12H17N5O — CID 136872417
2-amino-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol (PubChem CID 136872417) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-amino-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol.
| Compound Name | 2-amino-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 136872417 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-amino-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol |
| SMILES | CCNc1nnc(-c2ccc(O)c(N)c2)n1CC |
| InChI | InChI=1S/C12H17N5O/c1-3-14-12-16-15-11(17(12)4-2)8-5-6-10(18)9(13)7-8/h5-7,18H,3-4,13H2,1-2H3,(H,14,16) |
| InChIKey | VZWLOSXIIVQBMX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|