C12H15ClN4O — CID 136926768
2-chloro-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol (PubChem CID 136926768) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 2-chloro-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol.
| Compound Name | 2-chloro-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol |
|---|---|
| PubChem CID | 136926768 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-chloro-4-[4-ethyl-5-(ethylamino)-1,2,4-triazol-3-yl]phenol |
| SMILES | CCNc1nnc(-c2ccc(O)c(Cl)c2)n1CC |
| InChI | InChI=1S/C12H15ClN4O/c1-3-14-12-16-15-11(17(12)4-2)8-5-6-10(18)9(13)7-8/h5-7,18H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | VGQVPAVJZLWVOJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |