C12H15Cl2N5 — CID 112597405
5-(2-amino-3,5-dichlorophenyl)-N,4-diethyl-1,2,4-triazol-3-amine (PubChem CID 112597405) has the molecular formula C12H15Cl2N5 and a molecular weight of 300.19 g/mol. Its IUPAC name is 5-(2-amino-3,5-dichlorophenyl)-N,4-diethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(2-amino-3,5-dichlorophenyl)-N,4-diethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112597405 |
| Molecular Formula | C12H15Cl2N5 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 5-(2-amino-3,5-dichlorophenyl)-N,4-diethyl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(-c2cc(Cl)cc(Cl)c2N)n1CC |
| InChI | InChI=1S/C12H15Cl2N5/c1-3-16-12-18-17-11(19(12)4-2)8-5-7(13)6-9(14)10(8)15/h5-6H,3-4,15H2,1-2H3,(H,16,18) |
| InChIKey | ISFOUZZHKAVCOK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|