C12H14Br2N4 — CID 107938614
5-(2,4-dibromophenyl)-N,4-diethyl-1,2,4-triazol-3-amine (PubChem CID 107938614) has the molecular formula C12H14Br2N4 and a molecular weight of 374.08 g/mol. Its IUPAC name is 5-(2,4-dibromophenyl)-N,4-diethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(2,4-dibromophenyl)-N,4-diethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 107938614 |
| Molecular Formula | C12H14Br2N4 |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 5-(2,4-dibromophenyl)-N,4-diethyl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(-c2ccc(Br)cc2Br)n1CC |
| InChI | InChI=1S/C12H14Br2N4/c1-3-15-12-17-16-11(18(12)4-2)9-6-5-8(13)7-10(9)14/h5-7H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | QBJSILWCPYYDSB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |