C4H8N10 — CID 102444114
5-(4,5-diamino-1,2,4-triazol-3-yl)-1,2,4-triazole-3,4-diamine (PubChem CID 102444114) has the molecular formula C4H8N10 and a molecular weight of 196.18 g/mol. Its IUPAC name is 5-(4,5-diamino-1,2,4-triazol-3-yl)-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-(4,5-diamino-1,2,4-triazol-3-yl)-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 102444114 |
| Molecular Formula | C4H8N10 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 5-(4,5-diamino-1,2,4-triazol-3-yl)-1,2,4-triazole-3,4-diamine |
| SMILES | Nc1nnc(-c2nnc(N)n2N)n1N |
| InChI | InChI=1S/C4H8N10/c5-3-11-9-1(13(3)7)2-10-12-4(6)14(2)8/h7-8H2,(H2,5,11)(H2,6,12) |
| InChIKey | ACWIYSLOONRFJA-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 165.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |