About azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate
azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate (PubChem CID 139217308) has the molecular formula C3H7N9O
and a molecular weight of 185.15 g/mol. Its IUPAC name is azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate.
Analyze azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate?
The IUPAC name of azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate (CID 139217308) is azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate.
What is the SMILES notation for azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate?
The canonical SMILES for azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate is Nn1c([O-])nnc1-c1nn[nH]n1.[NH4+].
What is the InChIKey of azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate?
The InChIKey is VHOJXQKJICWDCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N8O.H3N/c4-11-2(7-8-3(11)12)1-5-9-10-6-1;/h4H2,(H,8,12)(H,5,6,9,10);1H3.
What are the key properties of azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate?
azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate has a molecular weight of 185.15 g/mol, XLogP of -2.38, 1 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 4-amino-5-(2H-tetrazol-5-yl)-1,2,4-triazol-3-olate is sourced from PubChem (CID 139217308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).