C4H6N8 — CID 573397
5,5'-Diamino-3,3'-bis-1,2,4-triazole (PubChem CID 573397) has the molecular formula C4H6N8 and a molecular weight of 166.15 g/mol. Its IUPAC name is 5-(3-amino-1H-1,2,4-triazol-5-yl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5,5'-Diamino-3,3'-bis-1,2,4-triazole |
|---|---|
| PubChem CID | 573397 |
| Molecular Formula | C4H6N8 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 5-(3-amino-1H-1,2,4-triazol-5-yl)-1H-1,2,4-triazol-3-amine |
| SMILES | C1(=NC(=NN1)N)C2=NC(=NN2)N |
| InChI | InChI=1S/C4H6N8/c5-3-7-1(9-11-3)2-8-4(6)12-10-2/h(H3,5,7,9,11)(H3,6,8,10,12) |
| InChIKey | SHHKWIJFVUHKCA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 143 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |