C3H2N10 — CID 136726291
5-(5-azido-1H-1,2,4-triazol-3-yl)-2H-tetrazole (PubChem CID 136726291) has the molecular formula C3H2N10 and a molecular weight of 178.12 g/mol. Its IUPAC name is 5-(5-azido-1H-1,2,4-triazol-3-yl)-2H-tetrazole.
| Compound Name | 5-(5-azido-1H-1,2,4-triazol-3-yl)-2H-tetrazole |
|---|---|
| PubChem CID | 136726291 |
| Molecular Formula | C3H2N10 |
| Molecular Weight | 178.12 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 5-(5-azido-1H-1,2,4-triazol-3-yl)-2H-tetrazole |
| SMILES | [N-]=[N+]=Nc1nc(-c2nn[nH]n2)n[nH]1 |
| InChI | InChI=1S/C3H2N10/c4-11-10-3-5-1(6-9-3)2-7-12-13-8-2/h(H,5,6,9)(H,7,8,12,13) |
| InChIKey | JWCUKMHJVLPGNG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.12 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|