C3H2N8O2 — CID 136726292
5-(5-nitro-1H-1,2,4-triazol-3-yl)-2H-tetrazole (PubChem CID 136726292) has the molecular formula C3H2N8O2 and a molecular weight of 182.10 g/mol. Its IUPAC name is 5-(5-nitro-1H-1,2,4-triazol-3-yl)-2H-tetrazole.
| Compound Name | 5-(5-nitro-1H-1,2,4-triazol-3-yl)-2H-tetrazole |
|---|---|
| PubChem CID | 136726292 |
| Molecular Formula | C3H2N8O2 |
| Molecular Weight | 182.10 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 5-(5-nitro-1H-1,2,4-triazol-3-yl)-2H-tetrazole |
| SMILES | O=[N+]([O-])c1nc(-c2nn[nH]n2)n[nH]1 |
| InChI | InChI=1S/C3H2N8O2/c12-11(13)3-4-1(5-8-3)2-6-9-10-7-2/h(H,4,5,8)(H,6,7,9,10) |
| InChIKey | MRONQGGZMDSGNE-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.10 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|