C4H8N10O6 — CID 139114666
nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-4-ium-5-yl]azanide;dihydrate (PubChem CID 139114666) has the molecular formula C4H8N10O6 and a molecular weight of 292.17 g/mol. Its IUPAC name is nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-4-ium-5-yl]azanide;dihydrate.
| Compound Name | nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-4-ium-5-yl]azanide;dihydrate |
|---|---|
| PubChem CID | 139114666 |
| Molecular Formula | C4H8N10O6 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | nitro-[3-(5-nitroazanidyl-1H-1,2,4-triazol-4-ium-3-yl)-1H-1,2,4-triazol-4-ium-5-yl]azanide;dihydrate |
| SMILES | O.O.O=[N+]([O-])[N-]c1[nH]nc(-c2n[nH]c([N-][N+](=O)[O-])[nH+]2)[nH+]1 |
| InChI | InChI=1S/C4H2N10O4.2H2O/c15-13(16)11-3-5-1(7-9-3)2-6-4(10-8-2)12-14(17)18;;/h(H2-2,5,6,7,8,9,10,11,12);2*1H2/q-2;;/p+2 |
| InChIKey | DLDWNHSUPJTRCL-UHFFFAOYSA-P |
| XLogP | -2.83 |
| TPSA | 263.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|